anotherstudent52 anotherstudent52

02-05-2020
Physics

contestada

What is the normal force of a 251.4 kg object resting on a surface (in Newton’s)

Respuesta :

Chelboy Chelboy

02-05-2020

Answer:2463.72N

Explanation:

Mass=254.4kg

Acceleration due to gravity=9.8m/s^2

Force =mass x acceleration due to gravity

Force=251.4 x 9.8

Force=2463.72N

Answer Link

Otras preguntas

here it is !!!! There you go

The half-life of sr-90 is 28 years. after 56 years of decay only 0. 40 g of a sample remains. what was the mass of the original sample? a. 0. 050 g b. 0. 10 g

For most of the nineteenth century, what city was the largest in the western part of the state?

What pressure will 14. 0 g of co exert in a 3. 5 l container at 75°c? a) 4. 1 atm b) 5. 0 atm c) 6. 4 atm d) 1. 1 atm

Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh

What are the consequence of variations in physical development on the adolescents social, emotional and cognitive development at large?give practical example

Peaking skills to work on for effective communication include __________. a. reading body language and active listening b. voice volume,

Identify the most likely reaction product(s) in the monobromination of 2-pentanone by bromine in the presence of acid in the dark

An object is marked for garbage collection once its _____ count reaches zero. a) increment b) reference c) argument d) parameter

How do you solve this?